| Name |
rel-1-(tert-Butyl) 3-methyl (3R,5R)-3,5-difluoro-4-oxopiperidine-1,3-dicarboxylate
|
| Molecular Formula |
C12H17F2NO5
|
| Molecular Weight |
293.26
|
| Smiles |
COC(=O)C1(F)CN(C(=O)OC(C)(C)C)CC(F)C1=O
|
COC(=O)C1(F)CN(C(=O)OC(C)(C)C)CC(F)C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.