| Name |
Ethyl 6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-((triisopropylsilyl)ethynyl)-2-naphthoate
|
| Molecular Formula |
C30H42BFO4Si
|
| Molecular Weight |
524.5
|
| Smiles |
CCOC(=O)c1cc(B2OC(C)(C)C(C)(C)O2)c2c(C#C[Si](C(C)C)(C(C)C)C(C)C)c(F)ccc2c1
|
CCOC(=O)c1cc(B2OC(C)(C)C(C)(C)O2)c2c(C#C[Si](C(C)C)(C(C)C)C(C)C)c(F)ccc2c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.