| Name |
tert-Butyl (2,5-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)carbamate
|
| Molecular Formula |
C19H30BNO4
|
| Molecular Weight |
347.3
|
| Smiles |
Cc1cc(NC(=O)OC(C)(C)C)c(C)c(B2OC(C)(C)C(C)(C)O2)c1
|
Cc1cc(NC(=O)OC(C)(C)C)c(C)c(B2OC(C)(C)C(C)(C)O2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.