| Name |
3-(4-Chloro-3,8-dimethyl-1H-pyrazolo[3,4-b]quinolin-1-yl)tetrahydrothiophene 1,1-dioxide
|
| Molecular Formula |
C16H16ClN3O2S
|
| Molecular Weight |
349.8
|
| Smiles |
Cc1cccc2c(Cl)c3c(C)nn(C4CCS(=O)(=O)C4)c3nc12
|
Cc1cccc2c(Cl)c3c(C)nn(C4CCS(=O)(=O)C4)c3nc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.