| Name |
I_a+/--D-Mannopyranoside, 2-(2-methoxyethoxy)ethyl, tetraacetate
|
| Molecular Formula |
C19H30O12
|
| Molecular Weight |
450.4
|
| Smiles |
COCCOCCOC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O
|
COCCOCCOC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.