| Name |
Methyl 4,5-diphenyl-2H-1,2,3-triazole-2-propanoate
|
| Molecular Formula |
C18H17N3O2
|
| Molecular Weight |
307.3
|
| Smiles |
COC(=O)CCn1nc(-c2ccccc2)c(-c2ccccc2)n1
|
COC(=O)CCn1nc(-c2ccccc2)c(-c2ccccc2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.