| Name |
(R)-2-(7-Chloro-3,4-dihydro-2H-pyrano[2,3-b]pyridin-4-yl)acetic acid
|
| Molecular Formula |
C10H10ClNO3
|
| Molecular Weight |
227.64
|
| Smiles |
O=C(O)CC1CCOc2nc(Cl)ccc21
|
O=C(O)CC1CCOc2nc(Cl)ccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.