| Name |
5-Chloro-3-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile
|
| Molecular Formula |
C14H17BClNO3
|
| Molecular Weight |
293.55
|
| Smiles |
COc1cc(Cl)cc(C#N)c1B1OC(C)(C)C(C)(C)O1
|
COc1cc(Cl)cc(C#N)c1B1OC(C)(C)C(C)(C)O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.