| Name |
Imidazo[1,5-d][1,2,4]triazine-1,4-dione, 2,3-dihydro-
|
| Molecular Formula |
C5H4N4O2
|
| Molecular Weight |
152.11
|
| Smiles |
O=c1[nH][nH]c(=O)n2cncc12
|
O=c1[nH][nH]c(=O)n2cncc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.