| Name |
3-(4-Methyl-1,2,3-thiadiazol-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
|
| Molecular Formula |
C14H18BN3O2S
|
| Molecular Weight |
303.2
|
| Smiles |
Cc1nnsc1-c1cncc(B2OC(C)(C)C(C)(C)O2)c1
|
Cc1nnsc1-c1cncc(B2OC(C)(C)C(C)(C)O2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.