| Name |
4-(((2S,3R,4S,5S,6S)-6-(Fluoromethyl)-3,4,5-trihydroxytetrahydro-2H-pyran-2-yl)oxy)-3-methoxybenzaldehyde
|
| Molecular Formula |
C14H17FO7
|
| Molecular Weight |
316.28
|
| Smiles |
COc1cc(C=O)ccc1OC1OC(CF)C(O)C(O)C1O
|
COc1cc(C=O)ccc1OC1OC(CF)C(O)C(O)C1O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.