| Name |
2-Bromo-5-cyclopropyl[1,2,4]triazolo[1,5-a]pyrimidin-7(1H)-one
|
| Molecular Formula |
C8H7BrN4O
|
| Molecular Weight |
255.07
|
| Smiles |
O=c1cc(C2CC2)nc2nc(Br)[nH]n12
|
O=c1cc(C2CC2)nc2nc(Br)[nH]n12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.