| Name |
4-Bromo-2,2-dimethyl-2,3-dihydrobenzofuran-7-carboxylic acid
|
| Molecular Formula |
C11H11BrO3
|
| Molecular Weight |
271.11
|
| Smiles |
CC1(C)Cc2c(Br)ccc(C(=O)O)c2O1
|
CC1(C)Cc2c(Br)ccc(C(=O)O)c2O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.