| Name |
1-(4-Chloro-2,5-difluorophenyl)-2,2-difluoroethan-1-one
|
| Molecular Formula |
C8H3ClF4O
|
| Molecular Weight |
226.55
|
| Smiles |
O=C(c1cc(F)c(Cl)cc1F)C(F)F
|
O=C(c1cc(F)c(Cl)cc1F)C(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.