| Name |
7-(2,5-dichlorothiophen-3-yl)-4H,5H,6H,7H-thieno[2,3-c]pyridine
|
| Molecular Formula |
C11H9Cl2NS2
|
| Molecular Weight |
290.2
|
| Smiles |
Clc1cc(C2NCCc3ccsc32)c(Cl)s1
|
Clc1cc(C2NCCc3ccsc32)c(Cl)s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.