| Name |
tert-butyl N-({7'-bromo-3',4'-dihydro-2'H-spiro[cyclopropane-1,1'-naphthalen]-3-yl}methyl)carbamate
|
| Molecular Formula |
C18H24BrNO2
|
| Molecular Weight |
366.3
|
| Smiles |
CC(C)(C)OC(=O)NCC1CC12CCCc1ccc(Br)cc12
|
CC(C)(C)OC(=O)NCC1CC12CCCc1ccc(Br)cc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.