| Name |
3-Pyridinecarboxaldehyde, 2-bromo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
|
| Molecular Formula |
C12H15BBrNO3
|
| Molecular Weight |
311.97
|
| Smiles |
CC1(C)OB(c2ccc(C=O)c(Br)n2)OC1(C)C
|
CC1(C)OB(c2ccc(C=O)c(Br)n2)OC1(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.