| Name |
2,2-Dimethyl-1-{pyrazolo[1,5-a]pyrimidin-2-yl}cyclopropan-1-amine
|
| Molecular Formula |
C11H14N4
|
| Molecular Weight |
202.26
|
| Smiles |
CC1(C)CC1(N)c1cc2ncccn2n1
|
CC1(C)CC1(N)c1cc2ncccn2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.