| Name |
3-(1,2,3,6-tetrahydropyridin-4-yl)-2H,4H,6H,7H-5lambda6-thiopyrano[4,3-c]pyrazole-5,5-dione
|
| Molecular Formula |
C11H15N3O2S
|
| Molecular Weight |
253.32
|
| Smiles |
O=S1(=O)CCc2[nH]nc(C3=CCNCC3)c2C1
|
O=S1(=O)CCc2[nH]nc(C3=CCNCC3)c2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.