| Name |
2,2'-(3,8-Dioctylpyrene-1,6-diyl)bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane)
|
| Molecular Formula |
C44H64B2O4
|
| Molecular Weight |
678.6
|
| Smiles |
CCCCCCCCc1cc(B2OC(C)(C)C(C)(C)O2)c2ccc3c(CCCCCCCC)cc(B4OC(C)(C)C(C)(C)O4)c4ccc1c2c34
|
CCCCCCCCc1cc(B2OC(C)(C)C(C)(C)O2)c2ccc3c(CCCCCCCC)cc(B4OC(C)(C)C(C)(C)O4)c4ccc1c2c34
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.