| Name |
rac-1-(azetidin-3-yl)-N-{[(3R,4R)-3,4-dimethylpyrrolidin-3-yl]methyl}-1H-pyrazol-5-amine
|
| Molecular Formula |
C13H23N5
|
| Molecular Weight |
249.36
|
| Smiles |
CC1CNCC1(C)CNc1ccnn1C1CNC1
|
CC1CNCC1(C)CNc1ccnn1C1CNC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.