| Name |
5-(propan-2-yl)-1-(1,1,1-trifluoropropan-2-yl)-1H-1,2,3-triazole-4-carboxamide
|
| Molecular Formula |
C9H13F3N4O
|
| Molecular Weight |
250.22
|
| Smiles |
CC(C)c1c(C(N)=O)nnn1C(C)C(F)(F)F
|
CC(C)c1c(C(N)=O)nnn1C(C)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.