| Name |
(4-Bromo-1,1-difluoro-3,3-dimethylbutyl)benzene
|
| Molecular Formula |
C12H15BrF2
|
| Molecular Weight |
277.15
|
| Smiles |
CC(C)(CBr)CC(F)(F)c1ccccc1
|
CC(C)(CBr)CC(F)(F)c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.