| Name |
3-(1-ethyl-1H-1,2,3-triazol-4-yl)-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanoic acid
|
| Molecular Formula |
C22H22N4O4
|
| Molecular Weight |
406.4
|
| Smiles |
CCn1cc(C(CC(=O)O)NC(=O)OCC2c3ccccc3-c3ccccc32)nn1
|
CCn1cc(C(CC(=O)O)NC(=O)OCC2c3ccccc3-c3ccccc32)nn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.