| Name |
2-tert-butyl 2-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) bicyclo[2.2.1]heptane-2,2-dicarboxylate
|
| Molecular Formula |
C21H23NO6
|
| Molecular Weight |
385.4
|
| Smiles |
CC(C)(C)OC(=O)C1(C(=O)ON2C(=O)c3ccccc3C2=O)CC2CCC1C2
|
CC(C)(C)OC(=O)C1(C(=O)ON2C(=O)c3ccccc3C2=O)CC2CCC1C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.