| Name |
2-(2,6-dioxopiperidin-3-yl)-5-{2-[2-(methylamino)ethyl]piperidin-1-yl}-2,3-dihydro-1H-isoindole-1,3-dione
|
| Molecular Formula |
C21H26N4O4
|
| Molecular Weight |
398.5
|
| Smiles |
CNCCC1CCCCN1c1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O
|
CNCCC1CCCCN1c1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.