| Name |
N-[4-chloro-3-(trifluoromethyl)phenyl]-4,7-dioxo-2-piperidin-1-yl-1,2,3,4a,5,6,8,8a-octahydropyrido[2,3-d]pyrimidine-5-carboxamide
|
| Molecular Formula |
C20H23ClF3N5O3
|
| Molecular Weight |
473.9
|
| Smiles |
O=C1CC(C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)C2C(=O)NC(N3CCCCC3)NC2N1
|
O=C1CC(C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)C2C(=O)NC(N3CCCCC3)NC2N1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.