| Name |
methyl 2-(3-tert-butyl-5-sulfanyl-4H-1,2,4-triazol-4-yl)acetate
|
| Molecular Formula |
C9H15N3O2S
|
| Molecular Weight |
229.30
|
| Smiles |
COC(=O)Cn1c(C(C)(C)C)n[nH]c1=S
|
COC(=O)Cn1c(C(C)(C)C)n[nH]c1=S
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.