| Name |
2-Ethyl-5-({[2-(trimethylsilyl)ethyl]sulfanyl}methyl)-1,3,4-oxadiazole
|
| Molecular Formula |
C10H20N2OSSi
|
| Molecular Weight |
244.43
|
| Smiles |
CCc1nnc(CSCC[Si](C)(C)C)o1
|
CCc1nnc(CSCC[Si](C)(C)C)o1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.