| Name |
1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2-{3-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]phenyl}-1,3-thiazole-4-carboxylate
|
| Molecular Formula |
C34H23N3O6S
|
| Molecular Weight |
601.6
|
| Smiles |
O=C(NCc1cccc(-c2nc(C(=O)ON3C(=O)c4ccccc4C3=O)cs2)c1)OCC1c2ccccc2-c2ccccc21
|
O=C(NCc1cccc(-c2nc(C(=O)ON3C(=O)c4ccccc4C3=O)cs2)c1)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.