| Name |
rac-1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl (2R,3R)-3-{[(benzyloxy)carbonyl]amino}bicyclo[2.2.1]hept-5-ene-2-carboxylate
|
| Molecular Formula |
C24H20N2O6
|
| Molecular Weight |
432.4
|
| Smiles |
O=C(NC1C2C=CC(C2)C1C(=O)ON1C(=O)c2ccccc2C1=O)OCc1ccccc1
|
O=C(NC1C2C=CC(C2)C1C(=O)ON1C(=O)c2ccccc2C1=O)OCc1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.