| Name |
rac-1-tert-butyl 3-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) (1R,3S)-cyclopentane-1,3-dicarboxylate
|
| Molecular Formula |
C19H21NO6
|
| Molecular Weight |
359.4
|
| Smiles |
CC(C)(C)OC(=O)C1CCC(C(=O)ON2C(=O)c3ccccc3C2=O)C1
|
CC(C)(C)OC(=O)C1CCC(C(=O)ON2C(=O)c3ccccc3C2=O)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.