| Name |
1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 3-ethyl 1-methylcyclopentane-1,3-dicarboxylate
|
| Molecular Formula |
C18H19NO6
|
| Molecular Weight |
345.3
|
| Smiles |
CCOC(=O)C1CCC(C)(C(=O)ON2C(=O)c3ccccc3C2=O)C1
|
CCOC(=O)C1CCC(C)(C(=O)ON2C(=O)c3ccccc3C2=O)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.