| Name |
1-tert-butyl 3-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 1H-indole-1,3-dicarboxylate
|
| Molecular Formula |
C22H18N2O6
|
| Molecular Weight |
406.4
|
| Smiles |
CC(C)(C)OC(=O)n1cc(C(=O)ON2C(=O)c3ccccc3C2=O)c2ccccc21
|
CC(C)(C)OC(=O)n1cc(C(=O)ON2C(=O)c3ccccc3C2=O)c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.