| Name |
{[5-(1-methoxyethyl)-1-(3-methylbutan-2-yl)-1H-1,2,3-triazol-4-yl]methyl}(methyl)amine
|
| Molecular Formula |
C12H24N4O
|
| Molecular Weight |
240.35
|
| Smiles |
CNCc1nnn(C(C)C(C)C)c1C(C)OC
|
CNCc1nnn(C(C)C(C)C)c1C(C)OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.