| Name |
2-(2,2,2-Trifluoroacetamido)-1,3-oxazole-4-carboxylic acid
|
| Molecular Formula |
C6H3F3N2O4
|
| Molecular Weight |
224.09
|
| Smiles |
O=C(O)c1coc(NC(=O)C(F)(F)F)n1
|
O=C(O)c1coc(NC(=O)C(F)(F)F)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.