| Name |
(1S,3AR,4S,4aS,5aR,6R,6aS)-2-(tert-butoxycarbonyl)decahydro-4,6-methanocyclopropa[f]isoindole-1-carboxylic acid
|
| Molecular Formula |
C16H23NO4
|
| Molecular Weight |
293.36
|
| Smiles |
CC(C)(C)OC(=O)N1CC2C3CC(C4CC43)C2C1C(=O)O
|
CC(C)(C)OC(=O)N1CC2C3CC(C4CC43)C2C1C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.