| Name |
3-Chloro-2-fluoro-4'-methyl-5-(trifluoromethyl)-1,1'-biphenyl
|
| Molecular Formula |
C14H9ClF4
|
| Molecular Weight |
288.67
|
| Smiles |
Cc1ccc(-c2cc(C(F)(F)F)cc(Cl)c2F)cc1
|
Cc1ccc(-c2cc(C(F)(F)F)cc(Cl)c2F)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.