| Name |
1-(5-Methyl-1,3-thiazol-2-yl)-4-{pyrazolo[1,5-a]pyrimidin-5-yloxy}piperidine
|
| Molecular Formula |
C15H17N5OS
|
| Molecular Weight |
315.4
|
| Smiles |
Cc1cnc(N2CCC(Oc3ccn4nccc4n3)CC2)s1
|
Cc1cnc(N2CCC(Oc3ccn4nccc4n3)CC2)s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.