| Name |
1-{5-Methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl}-4-{pyrazolo[1,5-a]pyrimidin-5-yloxy}piperidine
|
| Molecular Formula |
C17H18N8O
|
| Molecular Weight |
350.4
|
| Smiles |
Cc1cc(N2CCC(Oc3ccn4nccc4n3)CC2)n2ncnc2n1
|
Cc1cc(N2CCC(Oc3ccn4nccc4n3)CC2)n2ncnc2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.