| Name |
3-[(3-bromo-8,9-dihydro-6H-pyrido[4,3-b][1,8]naphthyridin-7-yl)methyl]thiolane 1,1-dioxide
|
| Molecular Formula |
C16H18BrN3O2S
|
| Molecular Weight |
396.3
|
| Smiles |
O=S1(=O)CCC(CN2CCc3nc4ncc(Br)cc4cc3C2)C1
|
O=S1(=O)CCC(CN2CCc3nc4ncc(Br)cc4cc3C2)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.