| Name |
3-(butylsulfanyl)-7-(2,4-dimethylphenyl)-7H,8H-[1,2,4]triazolo[4,3-a]pyrazin-8-one
|
| Molecular Formula |
C17H20N4OS
|
| Molecular Weight |
328.4
|
| Smiles |
CCCCSc1nnc2c(=O)n(-c3ccc(C)cc3C)ccn12
|
CCCCSc1nnc2c(=O)n(-c3ccc(C)cc3C)ccn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.