| Name |
N-(1-{3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-yl}piperidin-4-yl)cyclobutanecarboxamide
|
| Molecular Formula |
C16H22N6O
|
| Molecular Weight |
314.39
|
| Smiles |
Cc1nnc2c(N3CCC(NC(=O)C4CCC4)CC3)nccn12
|
Cc1nnc2c(N3CCC(NC(=O)C4CCC4)CC3)nccn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.