| Name |
N4-{[3-(benzyloxy)-5-chlorophenyl]methyl}-N1,N1-dimethylbenzene-1,4-diamine
|
| Molecular Formula |
C22H23ClN2O
|
| Molecular Weight |
366.9
|
| Smiles |
CN(C)c1ccc(NCc2cc(Cl)cc(OCc3ccccc3)c2)cc1
|
CN(C)c1ccc(NCc2cc(Cl)cc(OCc3ccccc3)c2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.