| Name |
tert-butyl N-(1-amino-3-{imidazo[1,2-a]pyridin-3-yl}propan-2-yl)carbamate
|
| Molecular Formula |
C15H22N4O2
|
| Molecular Weight |
290.36
|
| Smiles |
CC(C)(C)OC(=O)NC(CN)Cc1cnc2ccccn12
|
CC(C)(C)OC(=O)NC(CN)Cc1cnc2ccccn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.