| Name |
3-(4-Bromo-2,6-difluorophenyl)-3,3-difluoropropan-1-ol
|
| Molecular Formula |
C9H7BrF4O
|
| Molecular Weight |
287.05
|
| Smiles |
OCCC(F)(F)c1c(F)cc(Br)cc1F
|
OCCC(F)(F)c1c(F)cc(Br)cc1F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.