| Name |
2-Bromo-4-chlorothieno[2,3-b]pyridin-6(7H)-one
|
| Molecular Formula |
C7H3BrClNOS
|
| Molecular Weight |
264.53
|
| Smiles |
O=c1cc(Cl)c2cc(Br)sc2[nH]1
|
O=c1cc(Cl)c2cc(Br)sc2[nH]1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.