| Name |
3-{[3-(benzyloxy)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]methyl}-4-methylpentanoic acid
|
| Molecular Formula |
C33H38N2O6
|
| Molecular Weight |
558.7
|
| Smiles |
CC(C)C(CNC(=O)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(C)OCc1ccccc1)CC(=O)O
|
CC(C)C(CNC(=O)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(C)OCc1ccccc1)CC(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.