| Name |
N-{2-[2-(2-aminoethoxy)ethoxy]ethyl}-4-(2,4-dioxo-1,3-diazinan-1-yl)-3-methoxybenzamide hydrochloride
|
| Molecular Formula |
C18H27ClN4O6
|
| Molecular Weight |
430.9
|
| Smiles |
COc1cc(C(=O)NCCOCCOCCN)ccc1N1CCC(=O)NC1=O.Cl
|
COc1cc(C(=O)NCCOCCOCCN)ccc1N1CCC(=O)NC1=O.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.