| Name |
4,4,4-Trifluoro-3-{imidazo[1,2-a]pyridin-3-yl}butanoic acid
|
| Molecular Formula |
C11H9F3N2O2
|
| Molecular Weight |
258.20
|
| Smiles |
O=C(O)CC(c1cnc2ccccn12)C(F)(F)F
|
O=C(O)CC(c1cnc2ccccn12)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.